C15H21BrClF — CID 63834399
2-(2-bromo-4,5,5-trimethylhexyl)-1-chloro-3-fluorobenzene (PubChem CID 63834399) has the molecular formula C15H21BrClF and a molecular weight of 335.69 g/mol. Its IUPAC name is 2-(2-bromo-4,5,5-trimethylhexyl)-1-chloro-3-fluorobenzene.
| Compound Name | 2-(2-bromo-4,5,5-trimethylhexyl)-1-chloro-3-fluorobenzene |
|---|---|
| PubChem CID | 63834399 |
| Molecular Formula | C15H21BrClF |
| Molecular Weight | 335.69 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-(2-bromo-4,5,5-trimethylhexyl)-1-chloro-3-fluorobenzene |
| SMILES | CC(CC(Br)Cc1c(F)cccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H21BrClF/c1-10(15(2,3)4)8-11(16)9-12-13(17)6-5-7-14(12)18/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | METGBFLDFVNPGH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|