C16H25BrO — CID 63834726
1-(2-bromo-4,5,5-trimethylhexyl)-4-methoxybenzene (PubChem CID 63834726) has the molecular formula C16H25BrO and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-(2-bromo-4,5,5-trimethylhexyl)-4-methoxybenzene.
| Compound Name | 1-(2-bromo-4,5,5-trimethylhexyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 63834726 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(2-bromo-4,5,5-trimethylhexyl)-4-methoxybenzene |
| SMILES | COc1ccc(CC(Br)CC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25BrO/c1-12(16(2,3)4)10-14(17)11-13-6-8-15(18-5)9-7-13/h6-9,12,14H,10-11H2,1-5H3 |
| InChIKey | TXVUEWGRNFIDPW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|