C15H24O2 — CID 63832253
1-(4-methoxyphenyl)-3,4,4-trimethylpentan-1-ol (PubChem CID 63832253) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3,4,4-trimethylpentan-1-ol.
| Compound Name | 1-(4-methoxyphenyl)-3,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 63832253 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3,4,4-trimethylpentan-1-ol |
| SMILES | COc1ccc(C(O)CC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O2/c1-11(15(2,3)4)10-14(16)12-6-8-13(17-5)9-7-12/h6-9,11,14,16H,10H2,1-5H3 |
| InChIKey | OLRDNJFMHOYBAE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |