C15H22BrClO — CID 55261294
1-(1-bromo-3,4,4-trimethylpentyl)-2-chloro-4-methoxybenzene (PubChem CID 55261294) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is 1-(1-bromo-3,4,4-trimethylpentyl)-2-chloro-4-methoxybenzene.
| Compound Name | 1-(1-bromo-3,4,4-trimethylpentyl)-2-chloro-4-methoxybenzene |
|---|---|
| PubChem CID | 55261294 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(1-bromo-3,4,4-trimethylpentyl)-2-chloro-4-methoxybenzene |
| SMILES | COc1ccc(C(Br)CC(C)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H22BrClO/c1-10(15(2,3)4)8-13(16)12-7-6-11(18-5)9-14(12)17/h6-7,9-10,13H,8H2,1-5H3 |
| InChIKey | FQOKQJOQPSKOLG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|