C14H21BrO — CID 63543807
1-(2-bromo-3,3-dimethylpentyl)-4-methoxybenzene (PubChem CID 63543807) has the molecular formula C14H21BrO and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(2-bromo-3,3-dimethylpentyl)-4-methoxybenzene.
| Compound Name | 1-(2-bromo-3,3-dimethylpentyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 63543807 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(2-bromo-3,3-dimethylpentyl)-4-methoxybenzene |
| SMILES | CCC(C)(C)C(Br)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21BrO/c1-5-14(2,3)13(15)10-11-6-8-12(16-4)9-7-11/h6-9,13H,5,10H2,1-4H3 |
| InChIKey | FNKIHFYUYDAESO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|