C24H27NO — CID 15722769
N-[(1R,2S)-1,2-diphenyl-2-phenylmethoxyethyl]propan-2-amine (PubChem CID 15722769) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(1R,2S)-1,2-diphenyl-2-phenylmethoxyethyl]propan-2-amine.
| Compound Name | N-[(1R,2S)-1,2-diphenyl-2-phenylmethoxyethyl]propan-2-amine |
|---|---|
| PubChem CID | 15722769 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(1R,2S)-1,2-diphenyl-2-phenylmethoxyethyl]propan-2-amine |
| SMILES | CC(C)N[C@H](c1ccccc1)[C@@H](OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO/c1-19(2)25-23(21-14-8-4-9-15-21)24(22-16-10-5-11-17-22)26-18-20-12-6-3-7-13-20/h3-17,19,23-25H,18H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | FAAXEAOLDRMTGA-RPWUZVMVSA-N |
| XLogP | 5.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |