C20H25NO — CID 164669352
N,N-dimethyl-4-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]aniline (PubChem CID 164669352) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]aniline |
|---|---|
| PubChem CID | 164669352 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N,N-dimethyl-4-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]aniline |
| SMILES | C=C[C@@H](C)[C@@H](OCc1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H25NO/c1-5-16(2)20(22-15-17-9-7-6-8-10-17)18-11-13-19(14-12-18)21(3)4/h5-14,16,20H,1,15H2,2-4H3/t16-,20-/m1/s1 |
| InChIKey | OOVVXPHIHLUQAQ-OXQOHEQNSA-N |
| XLogP | 4.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|