C24H24O — CID 164669353
1-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]-4-phenylbenzene (PubChem CID 164669353) has the molecular formula C24H24O and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]-4-phenylbenzene.
| Compound Name | 1-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]-4-phenylbenzene |
|---|---|
| PubChem CID | 164669353 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[(1R,2R)-2-methyl-1-phenylmethoxybut-3-enyl]-4-phenylbenzene |
| SMILES | C=C[C@@H](C)[C@@H](OCc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O/c1-3-19(2)24(25-18-20-10-6-4-7-11-20)23-16-14-22(15-17-23)21-12-8-5-9-13-21/h3-17,19,24H,1,18H2,2H3/t19-,24-/m1/s1 |
| InChIKey | IJRSNJILGOEUGJ-NTKDMRAZSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|