C38H48N2O2 — CID 177391195
(1S,2S)-N,N'-bis[(2S)-3-methyl-1-phenylmethoxybutan-2-yl]-1,2-diphenylethane-1,2-diamine (PubChem CID 177391195) has the molecular formula C38H48N2O2 and a molecular weight of 564.81 g/mol. Its IUPAC name is (1S,2S)-N,N'-bis[(2S)-3-methyl-1-phenylmethoxybutan-2-yl]-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N'-bis[(2S)-3-methyl-1-phenylmethoxybutan-2-yl]-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 177391195 |
| Molecular Formula | C38H48N2O2 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | (1S,2S)-N,N'-bis[(2S)-3-methyl-1-phenylmethoxybutan-2-yl]-1,2-diphenylethane-1,2-diamine |
| SMILES | CC(C)[C@@H](COCc1ccccc1)N[C@@H](c1ccccc1)[C@@H](N[C@H](COCc1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H48N2O2/c1-29(2)35(27-41-25-31-17-9-5-10-18-31)39-37(33-21-13-7-14-22-33)38(34-23-15-8-16-24-34)40-36(30(3)4)28-42-26-32-19-11-6-12-20-32/h5-24,29-30,35-40H,25-28H2,1-4H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | ICXINNCSYBCIEP-RNATXAOGSA-N |
| XLogP | 8.13 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |