C30H31NO2 — CID 11812191
(1R,2S)-N-benzyl-1-phenyl-2,3-bis(phenylmethoxy)propan-1-amine (PubChem CID 11812191) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is (1R,2S)-N-benzyl-1-phenyl-2,3-bis(phenylmethoxy)propan-1-amine.
| Compound Name | (1R,2S)-N-benzyl-1-phenyl-2,3-bis(phenylmethoxy)propan-1-amine |
|---|---|
| PubChem CID | 11812191 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (1R,2S)-N-benzyl-1-phenyl-2,3-bis(phenylmethoxy)propan-1-amine |
| SMILES | c1ccc(CN[C@H](c2ccccc2)[C@@H](COCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31NO2/c1-5-13-25(14-6-1)21-31-30(28-19-11-4-12-20-28)29(33-23-27-17-9-3-10-18-27)24-32-22-26-15-7-2-8-16-26/h1-20,29-31H,21-24H2/t29-,30-/m1/s1 |
| InChIKey | MIPKPHFMBMAVTR-LOYHVIPDSA-N |
| XLogP | 6.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |