C17H16BrNO4 — CID 175172319
(2R,3S)-2-(benzamidomethyl)-3-(4-bromophenyl)-3-hydroxypropanoic acid (PubChem CID 175172319) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is (2R,3S)-2-(benzamidomethyl)-3-(4-bromophenyl)-3-hydroxypropanoic acid.
| Compound Name | (2R,3S)-2-(benzamidomethyl)-3-(4-bromophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175172319 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2R,3S)-2-(benzamidomethyl)-3-(4-bromophenyl)-3-hydroxypropanoic acid |
| SMILES | O=C(NC[C@@H](C(=O)O)[C@H](O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16BrNO4/c18-13-8-6-11(7-9-13)15(20)14(17(22)23)10-19-16(21)12-4-2-1-3-5-12/h1-9,14-15,20H,10H2,(H,19,21)(H,22,23)/t14-,15-/m1/s1 |
| InChIKey | IJLSMQNMXFQOME-HUUCEWRRSA-N |
| XLogP | 2.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |