C12H12F3NO4 — CID 68982145
(2S,3S)-2-(benzamidomethyl)-4,4,4-trifluoro-3-hydroxybutanoic acid (PubChem CID 68982145) has the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. Its IUPAC name is (2S,3S)-2-(benzamidomethyl)-4,4,4-trifluoro-3-hydroxybutanoic acid.
| Compound Name | (2S,3S)-2-(benzamidomethyl)-4,4,4-trifluoro-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 68982145 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2S,3S)-2-(benzamidomethyl)-4,4,4-trifluoro-3-hydroxybutanoic acid |
| SMILES | O=C(NC[C@H](C(=O)O)[C@H](O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO4/c13-12(14,15)9(17)8(11(19)20)6-16-10(18)7-4-2-1-3-5-7/h1-5,8-9,17H,6H2,(H,16,18)(H,19,20)/t8-,9-/m0/s1 |
| InChIKey | ZQXRQCYCFIGOEO-IUCAKERBSA-N |
| XLogP | 1.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |