C17H21N3O4 — CID 140688111
tert-butyl N-[[5-[(4-aminophenyl)carbamoyl]furan-2-yl]methyl]carbamate (PubChem CID 140688111) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is tert-butyl N-[[5-[(4-aminophenyl)carbamoyl]furan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[(4-aminophenyl)carbamoyl]furan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 140688111 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | tert-butyl N-[[5-[(4-aminophenyl)carbamoyl]furan-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)Nc2ccc(N)cc2)o1 |
| InChI | InChI=1S/C17H21N3O4/c1-17(2,3)24-16(22)19-10-13-8-9-14(23-13)15(21)20-12-6-4-11(18)5-7-12/h4-9H,10,18H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | GLDPRXNGSOZICE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|