C16H30N4O2 — CID 103720598
tert-butyl N-[2-ethyl-2-[(2-methylpyrazol-3-yl)methylamino]butyl]carbamate (PubChem CID 103720598) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-ethyl-2-[(2-methylpyrazol-3-yl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-ethyl-2-[(2-methylpyrazol-3-yl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 103720598 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[2-ethyl-2-[(2-methylpyrazol-3-yl)methylamino]butyl]carbamate |
| SMILES | CCC(CC)(CNC(=O)OC(C)(C)C)NCc1ccnn1C |
| InChI | InChI=1S/C16H30N4O2/c1-7-16(8-2,12-17-14(21)22-15(3,4)5)18-11-13-9-10-19-20(13)6/h9-10,18H,7-8,11-12H2,1-6H3,(H,17,21) |
| InChIKey | SAFXUFDGMHOOMX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |