C19H33N5O3 — CID 87007419
tert-butyl N-[1-[[(2-methylpyrazol-3-yl)methylcarbamoylamino]methyl]cycloheptyl]carbamate (PubChem CID 87007419) has the molecular formula C19H33N5O3 and a molecular weight of 379.51 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2-methylpyrazol-3-yl)methylcarbamoylamino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2-methylpyrazol-3-yl)methylcarbamoylamino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 87007419 |
| Molecular Formula | C19H33N5O3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | tert-butyl N-[1-[[(2-methylpyrazol-3-yl)methylcarbamoylamino]methyl]cycloheptyl]carbamate |
| SMILES | Cn1nccc1CNC(=O)NCC1(NC(=O)OC(C)(C)C)CCCCCC1 |
| InChI | InChI=1S/C19H33N5O3/c1-18(2,3)27-17(26)23-19(10-7-5-6-8-11-19)14-21-16(25)20-13-15-9-12-22-24(15)4/h9,12H,5-8,10-11,13-14H2,1-4H3,(H,23,26)(H2,20,21,25) |
| InChIKey | GLCGBEWFRWOUEF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |