C20H29BrN2O3 — CID 31862544
tert-butyl N-[1-[[(2-bromobenzoyl)amino]methyl]cycloheptyl]carbamate (PubChem CID 31862544) has the molecular formula C20H29BrN2O3 and a molecular weight of 425.37 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2-bromobenzoyl)amino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2-bromobenzoyl)amino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 31862544 |
| Molecular Formula | C20H29BrN2O3 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | tert-butyl N-[1-[[(2-bromobenzoyl)amino]methyl]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNC(=O)c2ccccc2Br)CCCCCC1 |
| InChI | InChI=1S/C20H29BrN2O3/c1-19(2,3)26-18(25)23-20(12-8-4-5-9-13-20)14-22-17(24)15-10-6-7-11-16(15)21/h6-7,10-11H,4-5,8-9,12-14H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | CCJCULCVMDYNMS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |