C23H33N3O3 — CID 31862587
tert-butyl N-[1-[[[2-(1H-indol-3-yl)acetyl]amino]methyl]cycloheptyl]carbamate (PubChem CID 31862587) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl N-[1-[[[2-(1H-indol-3-yl)acetyl]amino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[[2-(1H-indol-3-yl)acetyl]amino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 31862587 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | tert-butyl N-[1-[[[2-(1H-indol-3-yl)acetyl]amino]methyl]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNC(=O)Cc2c[nH]c3ccccc23)CCCCCC1 |
| InChI | InChI=1S/C23H33N3O3/c1-22(2,3)29-21(28)26-23(12-8-4-5-9-13-23)16-25-20(27)14-17-15-24-19-11-7-6-10-18(17)19/h6-7,10-11,15,24H,4-5,8-9,12-14,16H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | JYPZMSQBLHPMHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |