C20H36N2O4 — CID 60545517
tert-butyl N-[1-[[(2-cyclopentyloxyacetyl)amino]methyl]cycloheptyl]carbamate (PubChem CID 60545517) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2-cyclopentyloxyacetyl)amino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2-cyclopentyloxyacetyl)amino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 60545517 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | tert-butyl N-[1-[[(2-cyclopentyloxyacetyl)amino]methyl]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNC(=O)COC2CCCC2)CCCCCC1 |
| InChI | InChI=1S/C20H36N2O4/c1-19(2,3)26-18(24)22-20(12-8-4-5-9-13-20)15-21-17(23)14-25-16-10-6-7-11-16/h16H,4-15H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | SNUBZRNWMIXDKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |