C18H31N3O3 — CID 60545492
tert-butyl N-[1-[[(2-cyano-2-methylpropanoyl)amino]methyl]cycloheptyl]carbamate (PubChem CID 60545492) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2-cyano-2-methylpropanoyl)amino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2-cyano-2-methylpropanoyl)amino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 60545492 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[1-[[(2-cyano-2-methylpropanoyl)amino]methyl]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNC(=O)C(C)(C)C#N)CCCCCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-16(2,3)24-15(23)21-18(10-8-6-7-9-11-18)13-20-14(22)17(4,5)12-19/h6-11,13H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | RKQVHYVPYNGIQS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |