C22H39N3O4 — CID 55967344
tert-butyl N-[1-[[[2-(2-oxoazocan-1-yl)acetyl]amino]methyl]cycloheptyl]carbamate (PubChem CID 55967344) has the molecular formula C22H39N3O4 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl N-[1-[[[2-(2-oxoazocan-1-yl)acetyl]amino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[[2-(2-oxoazocan-1-yl)acetyl]amino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 55967344 |
| Molecular Formula | C22H39N3O4 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | tert-butyl N-[1-[[[2-(2-oxoazocan-1-yl)acetyl]amino]methyl]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNC(=O)CN2CCCCCCC2=O)CCCCCC1 |
| InChI | InChI=1S/C22H39N3O4/c1-21(2,3)29-20(28)24-22(13-9-5-6-10-14-22)17-23-18(26)16-25-15-11-7-4-8-12-19(25)27/h4-17H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | FDICERASWMNIDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |