C19H24N2O4 — CID 54016273
2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid (PubChem CID 54016273) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid.
| Compound Name | 2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid |
|---|---|
| PubChem CID | 54016273 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC=C(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H24N2O4/c1-19(2,3)25-18(24)20-10-6-7-13(17(22)23)11-14-12-21-16-9-5-4-8-15(14)16/h4-5,7-9,12,21H,6,10-11H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | KVVSSHJPOTUREC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|