C19H23BrN2O4 — CID 57047711
4-bromo-2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid (PubChem CID 57047711) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is 4-bromo-2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid.
| Compound Name | 4-bromo-2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid |
|---|---|
| PubChem CID | 57047711 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 4-bromo-2-(1H-indol-3-ylmethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(Br)C=C(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H23BrN2O4/c1-19(2,3)26-18(25)22-11-14(20)9-12(17(23)24)8-13-10-21-16-7-5-4-6-15(13)16/h4-7,9-10,14,21H,8,11H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | JRRVLQAENSULGN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|