C12H15Br2NO2S — CID 169468821
tert-butyl N-[3-(4,5-dibromothiophen-2-yl)prop-2-enyl]carbamate (PubChem CID 169468821) has the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. Its IUPAC name is tert-butyl N-[3-(4,5-dibromothiophen-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4,5-dibromothiophen-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468821 |
| Molecular Formula | C12H15Br2NO2S |
| Molecular Weight | 397.13 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | tert-butyl N-[3-(4,5-dibromothiophen-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H15Br2NO2S/c1-12(2,3)17-11(16)15-6-4-5-8-7-9(13)10(14)18-8/h4-5,7H,6H2,1-3H3,(H,15,16) |
| InChIKey | FVDUWWZJQGGEKH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.13 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |