C11H13Br2NO2 — CID 133061246
tert-butyl 2-(3,5-dibromo-2-pyridinyl)acetate (PubChem CID 133061246) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is tert-butyl 2-(3,5-dibromo-2-pyridinyl)acetate.
| Compound Name | tert-butyl 2-(3,5-dibromo-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 133061246 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | tert-butyl 2-(3,5-dibromo-2-pyridinyl)acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO2/c1-11(2,3)16-10(15)5-9-8(13)4-7(12)6-14-9/h4,6H,5H2,1-3H3 |
| InChIKey | WZFQGYQPUGPDSO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |