C18H26N4O3 — CID 113415120
tert-butyl N-[2-[4-[(2-methyl-1H-imidazol-5-yl)methylamino]phenoxy]ethyl]carbamate (PubChem CID 113415120) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2-methyl-1H-imidazol-5-yl)methylamino]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(2-methyl-1H-imidazol-5-yl)methylamino]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 113415120 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | tert-butyl N-[2-[4-[(2-methyl-1H-imidazol-5-yl)methylamino]phenoxy]ethyl]carbamate |
| SMILES | Cc1ncc(CNc2ccc(OCCNC(=O)OC(C)(C)C)cc2)[nH]1 |
| InChI | InChI=1S/C18H26N4O3/c1-13-20-11-15(22-13)12-21-14-5-7-16(8-6-14)24-10-9-19-17(23)25-18(2,3)4/h5-8,11,21H,9-10,12H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | UPSJASMHNIITED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|