C14H26N4O2 — CID 103740257
tert-butyl N-[2-methyl-1-[(2-methyl-1H-imidazol-5-yl)methylamino]propan-2-yl]carbamate (PubChem CID 103740257) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(2-methyl-1H-imidazol-5-yl)methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(2-methyl-1H-imidazol-5-yl)methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 103740257 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(2-methyl-1H-imidazol-5-yl)methylamino]propan-2-yl]carbamate |
| SMILES | Cc1ncc(CNCC(C)(C)NC(=O)OC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H26N4O2/c1-10-16-8-11(17-10)7-15-9-14(5,6)18-12(19)20-13(2,3)4/h8,15H,7,9H2,1-6H3,(H,16,17)(H,18,19) |
| InChIKey | CLRSTPVXWMMLER-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |