C17H23N3O2S — CID 70214405
tert-butyl N-[2-[1-(4-methylphenyl)sulfanylimidazol-4-yl]ethyl]carbamate (PubChem CID 70214405) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4-methylphenyl)sulfanylimidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(4-methylphenyl)sulfanylimidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70214405 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | tert-butyl N-[2-[1-(4-methylphenyl)sulfanylimidazol-4-yl]ethyl]carbamate |
| SMILES | Cc1ccc(Sn2cnc(CCNC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-13-5-7-15(8-6-13)23-20-11-14(19-12-20)9-10-18-16(21)22-17(2,3)4/h5-8,11-12H,9-10H2,1-4H3,(H,18,21) |
| InChIKey | KRAZLUQRVOEQGL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |