C17H29N3O2 — CID 68888242
tert-butyl N-[4-[2-(5-methyl-2-pyridinyl)ethylamino]butyl]carbamate (PubChem CID 68888242) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(5-methyl-2-pyridinyl)ethylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(5-methyl-2-pyridinyl)ethylamino]butyl]carbamate |
|---|---|
| PubChem CID | 68888242 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl N-[4-[2-(5-methyl-2-pyridinyl)ethylamino]butyl]carbamate |
| SMILES | Cc1ccc(CCNCCCCNC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C17H29N3O2/c1-14-7-8-15(20-13-14)9-12-18-10-5-6-11-19-16(21)22-17(2,3)4/h7-8,13,18H,5-6,9-12H2,1-4H3,(H,19,21) |
| InChIKey | AXVXPUAKKQJRQT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|