C10H18N4O2 — CID 141383386
tert-butyl N-(4-propyltriazol-1-yl)carbamate (PubChem CID 141383386) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl N-(4-propyltriazol-1-yl)carbamate.
| Compound Name | tert-butyl N-(4-propyltriazol-1-yl)carbamate |
|---|---|
| PubChem CID | 141383386 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | tert-butyl N-(4-propyltriazol-1-yl)carbamate |
| SMILES | CCCc1cn(NC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C10H18N4O2/c1-5-6-8-7-14(13-11-8)12-9(15)16-10(2,3)4/h7H,5-6H2,1-4H3,(H,12,15) |
| InChIKey | XUHYVJZTRKWWSG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |