C15H28N4O3 — CID 126827719
tert-butyl N-[1-[4-(2-hydroxy-2-methylbutyl)triazol-1-yl]propan-2-yl]carbamate (PubChem CID 126827719) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(2-hydroxy-2-methylbutyl)triazol-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(2-hydroxy-2-methylbutyl)triazol-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 126827719 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | tert-butyl N-[1-[4-(2-hydroxy-2-methylbutyl)triazol-1-yl]propan-2-yl]carbamate |
| SMILES | CCC(C)(O)Cc1cn(CC(C)NC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C15H28N4O3/c1-7-15(6,21)8-12-10-19(18-17-12)9-11(2)16-13(20)22-14(3,4)5/h10-11,21H,7-9H2,1-6H3,(H,16,20) |
| InChIKey | DVDQDPFDTPGHBE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |