C13H19FN2O4 — CID 175390386
5-fluoro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrrole-3-carboxylic acid (PubChem CID 175390386) has the molecular formula C13H19FN2O4 and a molecular weight of 286.30 g/mol. Its IUPAC name is 5-fluoro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrrole-3-carboxylic acid.
| Compound Name | 5-fluoro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 175390386 |
| Molecular Formula | C13H19FN2O4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-fluoro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrrole-3-carboxylic acid |
| SMILES | CC(Cn1cc(C(=O)O)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19FN2O4/c1-8(15-12(19)20-13(2,3)4)6-16-7-9(11(17)18)5-10(16)14/h5,7-8H,6H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | DXYBDBPKSBICAG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |