C16H20FIN2O2 — CID 22612704
tert-butyl N-[1-(5-fluoro-6-iodoindol-1-yl)propan-2-yl]carbamate (PubChem CID 22612704) has the molecular formula C16H20FIN2O2 and a molecular weight of 418.25 g/mol. Its IUPAC name is tert-butyl N-[1-(5-fluoro-6-iodoindol-1-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-fluoro-6-iodoindol-1-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 22612704 |
| Molecular Formula | C16H20FIN2O2 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | tert-butyl N-[1-(5-fluoro-6-iodoindol-1-yl)propan-2-yl]carbamate |
| SMILES | CC(Cn1ccc2cc(F)c(I)cc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20FIN2O2/c1-10(19-15(21)22-16(2,3)4)9-20-6-5-11-7-12(17)13(18)8-14(11)20/h5-8,10H,9H2,1-4H3,(H,19,21) |
| InChIKey | NMMLVJZEIHXTIW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|