C21H38BFN4O4 — CID 171110702
tert-butyl N-[1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazol-1-yl]propan-2-yl]carbamate;propane (PubChem CID 171110702) has the molecular formula C21H38BFN4O4 and a molecular weight of 440.37 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazol-1-yl]propan-2-yl]carbamate;propane.
| Compound Name | tert-butyl N-[1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazol-1-yl]propan-2-yl]carbamate;propane |
|---|---|
| PubChem CID | 171110702 |
| Molecular Formula | C21H38BFN4O4 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | tert-butyl N-[1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazol-1-yl]propan-2-yl]carbamate;propane |
| SMILES | CC(Cn1cc(C=C(F)B2OC(C)(C)C(C)(C)O2)nn1)NC(=O)OC(C)(C)C.CCC |
| InChI | InChI=1S/C18H30BFN4O4.C3H8/c1-12(21-15(25)26-16(2,3)4)10-24-11-13(22-23-24)9-14(20)19-27-17(5,6)18(7,8)28-19;1-3-2/h9,11-12H,10H2,1-8H3,(H,21,25);3H2,1-2H3 |
| InChIKey | OVAYNNXDJFFGII-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|