C38H57N8O3PSi — CID 172541327
4-N-(2-dimethylphosphorylphenyl)-2-N-[5-ethyl-2-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 172541327) has the molecular formula C38H57N8O3PSi and a molecular weight of 732.99 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-2-N-[5-ethyl-2-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[5-ethyl-2-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 172541327 |
| Molecular Formula | C38H57N8O3PSi |
| Molecular Weight | 732.99 g/mol |
| Exact Mass | 732.41 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[5-ethyl-2-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCc1cc(Nc2nc(Nc3ccccc3P(C)(C)=O)c3ccn(COCC[Si](C)(C)C)c3n2)c(OC)cc1N1CCC(N2CCNCC2)CC1 |
| InChI | InChI=1S/C38H57N8O3PSi/c1-8-28-25-32(34(48-2)26-33(28)45-18-13-29(14-19-45)44-21-16-39-17-22-44)41-38-42-36(40-31-11-9-10-12-35(31)50(3,4)47)30-15-20-46(37(30)43-38)27-49-23-24-51(5,6)7/h9-12,15,20,25-26,29,39H,8,13-14,16-19,21-24,27H2,1-7H3,(H2,40,41,42,43) |
| InChIKey | XOIWMNXMAKIECF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.99 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|