C33H31BrN4O2Si — CID 87287642
2-[6-bromo-9-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 87287642) has the molecular formula C33H31BrN4O2Si and a molecular weight of 623.63 g/mol. Its IUPAC name is 2-[6-bromo-9-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[6-bromo-9-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 87287642 |
| Molecular Formula | C33H31BrN4O2Si |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 2-[6-bromo-9-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(-c2c(C#N)cccc2C#N)nc2c3ccc(Br)cc3c3cc(OCC4CC4)ccc3c21 |
| InChI | InChI=1S/C33H31BrN4O2Si/c1-41(2,3)14-13-39-20-38-32-27-12-10-25(40-19-21-7-8-21)16-29(27)28-15-24(34)9-11-26(28)31(32)37-33(38)30-22(17-35)5-4-6-23(30)18-36/h4-6,9-12,15-16,21H,7-8,13-14,19-20H2,1-3H3 |
| InChIKey | NTRTXDHBVCIMNR-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 83.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|