C19H28N6OSi — CID 140943272
7-cyclopropyl-N-(1-methylpyrazol-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine (PubChem CID 140943272) has the molecular formula C19H28N6OSi and a molecular weight of 384.56 g/mol. Its IUPAC name is 7-cyclopropyl-N-(1-methylpyrazol-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 7-cyclopropyl-N-(1-methylpyrazol-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 140943272 |
| Molecular Formula | C19H28N6OSi |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 7-cyclopropyl-N-(1-methylpyrazol-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine |
| SMILES | Cn1ccc(Nc2cc(C3CC3)c3ncn(COCC[Si](C)(C)C)c3n2)n1 |
| InChI | InChI=1S/C19H28N6OSi/c1-24-8-7-16(23-24)21-17-11-15(14-5-6-14)18-19(22-17)25(12-20-18)13-26-9-10-27(2,3)4/h7-8,11-12,14H,5-6,9-10,13H2,1-4H3,(H,21,22,23) |
| InChIKey | JJKBGJIIDKSRKS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|