C23H34ClN5O3Si — CID 162477874
3-chloro-5-[3-methoxy-1-(oxan-4-yl)pyrazol-4-yl]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 162477874) has the molecular formula C23H34ClN5O3Si and a molecular weight of 492.10 g/mol. Its IUPAC name is 3-chloro-5-[3-methoxy-1-(oxan-4-yl)pyrazol-4-yl]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 3-chloro-5-[3-methoxy-1-(oxan-4-yl)pyrazol-4-yl]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 162477874 |
| Molecular Formula | C23H34ClN5O3Si |
| Molecular Weight | 492.10 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-chloro-5-[3-methoxy-1-(oxan-4-yl)pyrazol-4-yl]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CNc1c(-c2cn(C3CCOCC3)nc2OC)cnc2c1c(Cl)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H34ClN5O3Si/c1-25-21-17(18-13-29(27-23(18)30-2)16-6-8-31-9-7-16)12-26-22-20(21)19(24)14-28(22)15-32-10-11-33(3,4)5/h12-14,16H,6-11,15H2,1-5H3,(H,25,26) |
| InChIKey | LGASZNHEXPPOJD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.10 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|