C20H18Cl2F6N6O4Si — CID 174147144
CID 174147144 (PubChem CID 174147144) has the molecular formula C20H18Cl2F6N6O4Si and a molecular weight of 619.38 g/mol.
| Compound Name | CID 174147144 |
|---|---|
| PubChem CID | 174147144 |
| Molecular Formula | C20H18Cl2F6N6O4Si |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 618.04 |
| IUPAC Name | — |
| SMILES | C[Si]C(COCn1cc(C(F)(F)F)c2c(NCCCOc3nc(Cl)ccc3[N+](=O)[O-])nc(Cl)nc21)C(F)(F)F |
| InChI | InChI=1S/C20H18Cl2F6N6O4Si/c1-39-12(20(26,27)28)8-37-9-33-7-10(19(23,24)25)14-15(31-18(22)32-16(14)33)29-5-2-6-38-17-11(34(35)36)3-4-13(21)30-17/h3-4,7,12H,2,5-6,8-9H2,1H3,(H,29,31,32) |
| InChIKey | VPTMDLFANQAPKV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|