C7H4ClF3N2O3 — CID 43152615
6-chloro-3-nitro-2-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 43152615) has the molecular formula C7H4ClF3N2O3 and a molecular weight of 256.57 g/mol. Its IUPAC name is 6-chloro-3-nitro-2-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 6-chloro-3-nitro-2-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 43152615 |
| Molecular Formula | C7H4ClF3N2O3 |
| Molecular Weight | 256.57 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 6-chloro-3-nitro-2-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1OCC(F)(F)F |
| InChI | InChI=1S/C7H4ClF3N2O3/c8-5-2-1-4(13(14)15)6(12-5)16-3-7(9,10)11/h1-2H,3H2 |
| InChIKey | ZJUQBSZTBLOKFQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|