C13H18ClN3O5 — CID 175510540
[1-[(6-chloro-3-nitro-2-pyridinyl)oxy]-4,4-dimethylpentan-3-yl] carbamate (PubChem CID 175510540) has the molecular formula C13H18ClN3O5 and a molecular weight of 331.76 g/mol. Its IUPAC name is [1-[(6-chloro-3-nitro-2-pyridinyl)oxy]-4,4-dimethylpentan-3-yl] carbamate.
| Compound Name | [1-[(6-chloro-3-nitro-2-pyridinyl)oxy]-4,4-dimethylpentan-3-yl] carbamate |
|---|---|
| PubChem CID | 175510540 |
| Molecular Formula | C13H18ClN3O5 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [1-[(6-chloro-3-nitro-2-pyridinyl)oxy]-4,4-dimethylpentan-3-yl] carbamate |
| SMILES | CC(C)(C)C(CCOc1nc(Cl)ccc1[N+](=O)[O-])OC(N)=O |
| InChI | InChI=1S/C13H18ClN3O5/c1-13(2,3)9(22-12(15)18)6-7-21-11-8(17(19)20)4-5-10(14)16-11/h4-5,9H,6-7H2,1-3H3,(H2,15,18) |
| InChIKey | JBCLBCIHSFVXRQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|