C10H14ClN3O4 — CID 106162464
3-[(6-chloro-3-nitro-2-pyridinyl)amino]-4-methoxybutan-1-ol (PubChem CID 106162464) has the molecular formula C10H14ClN3O4 and a molecular weight of 275.69 g/mol. Its IUPAC name is 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106162464 |
| Molecular Formula | C10H14ClN3O4 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14ClN3O4/c1-18-6-7(4-5-15)12-10-8(14(16)17)2-3-9(11)13-10/h2-3,7,15H,4-6H2,1H3,(H,12,13) |
| InChIKey | OXRFKIMAZFEZSP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|