C11H17N3O5 — CID 106157692
4-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]butan-1-ol (PubChem CID 106157692) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 4-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106157692 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]butan-1-ol |
| SMILES | COCC(CCO)Nc1nc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O5/c1-18-7-8(5-6-15)12-11-9(14(16)17)3-4-10(13-11)19-2/h3-4,8,15H,5-7H2,1-2H3,(H,12,13) |
| InChIKey | NMQJVZRYXNWJNK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|