C10H15N3O5 — CID 79889536
1-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]propan-2-ol (PubChem CID 79889536) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]propan-2-ol.
| Compound Name | 1-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 79889536 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-methoxy-3-[(6-methoxy-3-nitro-2-pyridinyl)amino]propan-2-ol |
| SMILES | COCC(O)CNc1nc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O5/c1-17-6-7(14)5-11-10-8(13(15)16)3-4-9(12-10)18-2/h3-4,7,14H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | SYMQZXDJVSVMFG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|