C10H15N3O4 — CID 80712438
1-methoxy-3-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-2-ol (PubChem CID 80712438) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-methoxy-3-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-2-ol.
| Compound Name | 1-methoxy-3-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 80712438 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-methoxy-3-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-2-ol |
| SMILES | COCC(O)CNc1ccc([N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C10H15N3O4/c1-7-9(13(15)16)3-4-10(12-7)11-5-8(14)6-17-2/h3-4,8,14H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | XGXLCIFVMSJJBT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|