C20H25Cl3N6O4Si — CID 170590010
2,5-dichloro-N-[3-[(6-chloro-3-nitro-2-pyridinyl)oxy]propyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 170590010) has the molecular formula C20H25Cl3N6O4Si and a molecular weight of 547.90 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[(6-chloro-3-nitro-2-pyridinyl)oxy]propyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[3-[(6-chloro-3-nitro-2-pyridinyl)oxy]propyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170590010 |
| Molecular Formula | C20H25Cl3N6O4Si |
| Molecular Weight | 547.90 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 2,5-dichloro-N-[3-[(6-chloro-3-nitro-2-pyridinyl)oxy]propyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(NCCCOc3nc(Cl)ccc3[N+](=O)[O-])nc(Cl)nc21 |
| InChI | InChI=1S/C20H25Cl3N6O4Si/c1-34(2,3)10-9-32-12-28-11-13(21)16-17(26-20(23)27-18(16)28)24-7-4-8-33-19-14(29(30)31)5-6-15(22)25-19/h5-6,11H,4,7-10,12H2,1-3H3,(H,24,26,27) |
| InChIKey | DFSYQOFSIUADGA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|