About diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate
diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate (PubChem CID 19977730) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate |
| PubChem CID | 19977730 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(cc(-c3ccccc3)n2O)nc1C(=O)OCC |
| InChI | InChI=1S/C19H18N2O5/c1-3-25-18(22)13-10-16-14(20-17(13)19(23)26-4-2)11-15(21(16)24)12-8-6-5-7-9-12/h5-11,24H,3-4H2,1-2H3 |
| InChIKey | OERXISAJONBMMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate?
The IUPAC name of diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate (CID 19977730) is diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate.
What is the SMILES notation for diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate?
The canonical SMILES for diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate is CCOC(=O)c1cc2c(cc(-c3ccccc3)n2O)nc1C(=O)OCC.
What is the InChIKey of diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate?
The InChIKey is OERXISAJONBMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-3-25-18(22)13-10-16-14(20-17(13)19(23)26-4-2)11-15(21(16)24)12-8-6-5-7-9-12/h5-11,24H,3-4H2,1-2H3.
What are the key properties of diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate?
diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate has a molecular weight of 354.36 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-hydroxy-2-phenylpyrrolo[3,2-b]pyridine-5,6-dicarboxylate is sourced from PubChem (CID 19977730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).