C17H16N2O4 — CID 11723020
diethyl pyrido[2,3-b]indole-3,9-dicarboxylate (PubChem CID 11723020) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is diethyl pyrido[2,3-b]indole-3,9-dicarboxylate.
| Compound Name | diethyl pyrido[2,3-b]indole-3,9-dicarboxylate |
|---|---|
| PubChem CID | 11723020 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | diethyl pyrido[2,3-b]indole-3,9-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)c1ccccc1n2C(=O)OCC |
| InChI | InChI=1S/C17H16N2O4/c1-3-22-16(20)11-9-13-12-7-5-6-8-14(12)19(15(13)18-10-11)17(21)23-4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | WEYYDBILOHGLGG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |