C15H13N3O4 — CID 13060569
ethyl 7-methyl-4,6-dioxopyrimido[1,2-c]quinazoline-3-carboxylate (PubChem CID 13060569) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is ethyl 7-methyl-4,6-dioxopyrimido[1,2-c]quinazoline-3-carboxylate.
| Compound Name | ethyl 7-methyl-4,6-dioxopyrimido[1,2-c]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13060569 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | ethyl 7-methyl-4,6-dioxopyrimido[1,2-c]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c3ccccc3n(C)c(=O)n2c1=O |
| InChI | InChI=1S/C15H13N3O4/c1-3-22-14(20)10-8-16-12-9-6-4-5-7-11(9)17(2)15(21)18(12)13(10)19/h4-8H,3H2,1-2H3 |
| InChIKey | SOLAHOLKWWBZGE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|