C18H14N2O3 — CID 165352312
ethyl 5-oxo-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7,9,11,13,15-heptaene-4-carboxylate (PubChem CID 165352312) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl 5-oxo-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7,9,11,13,15-heptaene-4-carboxylate.
| Compound Name | ethyl 5-oxo-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7,9,11,13,15-heptaene-4-carboxylate |
|---|---|
| PubChem CID | 165352312 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 5-oxo-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,7,9,11,13,15-heptaene-4-carboxylate |
| SMILES | CCOC(=O)c1cn2c3ccccc3c3ccccc3n2c1=O |
| InChI | InChI=1S/C18H14N2O3/c1-2-23-18(22)14-11-19-15-9-5-3-7-12(15)13-8-4-6-10-16(13)20(19)17(14)21/h3-11H,2H2,1H3 |
| InChIKey | KGXMYAQSDTYOQO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|