C17H17N2O4+ — CID 7056972
ethyl 2-(ethylamino)-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate (PubChem CID 7056972) has the molecular formula C17H17N2O4+ and a molecular weight of 313.33 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 2-(ethylamino)-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7056972 |
| Molecular Formula | C17H17N2O4+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 2-(ethylamino)-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate |
| SMILES | CCNc1[nH+]c2c(cc1C(=O)OCC)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C17H16N2O4/c1-3-18-15-12(16(20)22-4-2)9-11-14(19-15)10-7-5-6-8-13(10)23-17(11)21/h5-9H,3-4H2,1-2H3,(H,18,19)/p+1 |
| InChIKey | NSVPEIDDWNWTPZ-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|